C36H38N4O12 — CID 70569560
bis(2-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]benzoic acid);ethane-1,1-diamine (PubChem CID 70569560) has the molecular formula C36H38N4O12 and a molecular weight of 718.72 g/mol. Its IUPAC name is bis(2-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]benzoic acid);ethane-1,1-diamine.
| Compound Name | bis(2-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]benzoic acid);ethane-1,1-diamine |
|---|---|
| PubChem CID | 70569560 |
| Molecular Formula | C36H38N4O12 |
| Molecular Weight | 718.72 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | bis(2-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]benzoic acid);ethane-1,1-diamine |
| SMILES | CC(N)N.O=C(O)c1ccccc1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O.O=C(O)c1ccccc1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/2C17H15NO6.C2H8N2/c2*19-11-7-5-10(6-8-11)9-14(17(23)24)18-15(20)12-3-1-2-4-13(12)16(21)22;1-2(3)4/h2*1-8,14,19H,9H2,(H,18,20)(H,21,22)(H,23,24);2H,3-4H2,1H3/t2*14-;/m00./s1 |
| InChIKey | LFLWFNHZRCSHOZ-VJOCCTOCSA-N |
| XLogP | 2.28 |
| TPSA | 299.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.72 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|