C19H17N3O5 — CID 87926953
2-[[1-[cyano(methyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]benzoic acid (PubChem CID 87926953) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[[1-[cyano(methyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[1-[cyano(methyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 87926953 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[[1-[cyano(methyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]benzoic acid |
| SMILES | CN(C#N)C(=O)C(Cc1ccc(O)cc1)NC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C19H17N3O5/c1-22(11-20)18(25)16(10-12-6-8-13(23)9-7-12)21-17(24)14-4-2-3-5-15(14)19(26)27/h2-9,16,23H,10H2,1H3,(H,21,24)(H,26,27) |
| InChIKey | NRBGYTQQBHLLDP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|