C23H19N3O4 — CID 58752372
2-[[(2S)-1-(cyanomethylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]benzoic acid (PubChem CID 58752372) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-[[(2S)-1-(cyanomethylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[(2S)-1-(cyanomethylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 58752372 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[[(2S)-1-(cyanomethylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]benzoic acid |
| SMILES | N#CCNC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C23H19N3O4/c24-11-12-25-22(28)20(14-15-9-10-16-5-1-2-6-17(16)13-15)26-21(27)18-7-3-4-8-19(18)23(29)30/h1-10,13,20H,12,14H2,(H,25,28)(H,26,27)(H,29,30)/t20-/m0/s1 |
| InChIKey | URHRCIURBUXWKO-FQEVSTJZSA-N |
| XLogP | 2.52 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|