C25H23F3N4OS — CID 87927206
N-(2-cyanoethyl)-3-naphthalen-2-yl-2-[[4-(2,2,2-trifluoroethyl)phenyl]carbamothioylamino]propanamide (PubChem CID 87927206) has the molecular formula C25H23F3N4OS and a molecular weight of 484.55 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-naphthalen-2-yl-2-[[4-(2,2,2-trifluoroethyl)phenyl]carbamothioylamino]propanamide.
| Compound Name | N-(2-cyanoethyl)-3-naphthalen-2-yl-2-[[4-(2,2,2-trifluoroethyl)phenyl]carbamothioylamino]propanamide |
|---|---|
| PubChem CID | 87927206 |
| Molecular Formula | C25H23F3N4OS |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-(2-cyanoethyl)-3-naphthalen-2-yl-2-[[4-(2,2,2-trifluoroethyl)phenyl]carbamothioylamino]propanamide |
| SMILES | N#CCCNC(=O)C(Cc1ccc2ccccc2c1)NC(=S)Nc1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23F3N4OS/c26-25(27,28)16-17-7-10-21(11-8-17)31-24(34)32-22(23(33)30-13-3-12-29)15-18-6-9-19-4-1-2-5-20(19)14-18/h1-2,4-11,14,22H,3,13,15-16H2,(H,30,33)(H2,31,32,34) |
| InChIKey | QYHQXWYJWVBOOY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|