C25H24N4O3 — CID 87927939
4-acetamido-N-[1-[cyano(ethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide (PubChem CID 87927939) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-acetamido-N-[1-[cyano(ethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-acetamido-N-[1-[cyano(ethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 87927939 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-acetamido-N-[1-[cyano(ethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide |
| SMILES | CCN(C#N)C(=O)C(Cc1ccc2ccccc2c1)NC(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-3-29(16-26)25(32)23(15-18-8-9-19-6-4-5-7-21(19)14-18)28-24(31)20-10-12-22(13-11-20)27-17(2)30/h4-14,23H,3,15H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | DKOFSVZDTDXOJL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|