C27H24N4O4 — CID 91129100
4-amino-N-[1-[N-(hydroxycarbamoyl)anilino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide (PubChem CID 91129100) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is 4-amino-N-[1-[N-(hydroxycarbamoyl)anilino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-amino-N-[1-[N-(hydroxycarbamoyl)anilino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 91129100 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-amino-N-[1-[N-(hydroxycarbamoyl)anilino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide |
| SMILES | Nc1ccc(C(=O)NC(Cc2ccc3ccccc3c2)C(=O)N(C(=O)NO)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N4O4/c28-22-14-12-20(13-15-22)25(32)29-24(17-18-10-11-19-6-4-5-7-21(19)16-18)26(33)31(27(34)30-35)23-8-2-1-3-9-23/h1-16,24,35H,17,28H2,(H,29,32)(H,30,34) |
| InChIKey | FHUPZVDPDSQVNY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|