C16H16N2O4 — CID 12804970
(2S)-2-[(4-aminobenzoyl)amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 12804970) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is (2S)-2-[(4-aminobenzoyl)amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[(4-aminobenzoyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 12804970 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2S)-2-[(4-aminobenzoyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | Nc1ccc(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H16N2O4/c17-12-5-3-11(4-6-12)15(20)18-14(16(21)22)9-10-1-7-13(19)8-2-10/h1-8,14,19H,9,17H2,(H,18,20)(H,21,22)/t14-/m0/s1 |
| InChIKey | KXKQQQIJZIRWPE-AWEZNQCLSA-N |
| XLogP | 1.40 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|