C16H14NO4- — CID 53456337
2-benzamido-3-(4-hydroxyphenyl)propanoate (PubChem CID 53456337) has the molecular formula C16H14NO4- and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-benzamido-3-(4-hydroxyphenyl)propanoate.
| Compound Name | 2-benzamido-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 53456337 |
| Molecular Formula | C16H14NO4- |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-benzamido-3-(4-hydroxyphenyl)propanoate |
| SMILES | O=C(NC(Cc1ccc(O)cc1)C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H15NO4/c18-13-8-6-11(7-9-13)10-14(16(20)21)17-15(19)12-4-2-1-3-5-12/h1-9,14,18H,10H2,(H,17,19)(H,20,21)/p-1 |
| InChIKey | KUUUDPTUEOKITK-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |