C29H23F3N2O3 — CID 58718001
(2S)-3-[4-(4-aminophenyl)phenyl]-2-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid (PubChem CID 58718001) has the molecular formula C29H23F3N2O3 and a molecular weight of 504.51 g/mol. Its IUPAC name is (2S)-3-[4-(4-aminophenyl)phenyl]-2-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(4-aminophenyl)phenyl]-2-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58718001 |
| Molecular Formula | C29H23F3N2O3 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (2S)-3-[4-(4-aminophenyl)phenyl]-2-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid |
| SMILES | Nc1ccc(-c2ccc(C[C@H](NC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H23F3N2O3/c30-29(31,32)24-13-9-21(10-14-24)20-5-7-23(8-6-20)27(35)34-26(28(36)37)17-18-1-3-19(4-2-18)22-11-15-25(33)16-12-22/h1-16,26H,17,33H2,(H,34,35)(H,36,37)/t26-/m0/s1 |
| InChIKey | LPBWDTSKTNCFDH-SANMLTNESA-N |
| XLogP | 6.05 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|