C17H16FNO3 — CID 132893045
3-(4-fluorophenyl)-2-[(4-methylbenzoyl)amino]propanoic acid (PubChem CID 132893045) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[(4-methylbenzoyl)amino]propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-2-[(4-methylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 132893045 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[(4-methylbenzoyl)amino]propanoic acid |
| SMILES | Cc1ccc(C(=O)NC(Cc2ccc(F)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H16FNO3/c1-11-2-6-13(7-3-11)16(20)19-15(17(21)22)10-12-4-8-14(18)9-5-12/h2-9,15H,10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | QZNJLYDDIHPGQO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |