C16H14FNO3 — CID 34256707
N-[(1R)-2-(4-fluorophenyl)-1-hydroxy-2-oxoethyl]-4-methylbenzamide (PubChem CID 34256707) has the molecular formula C16H14FNO3 and a molecular weight of 287.29 g/mol. Its IUPAC name is N-[(1R)-2-(4-fluorophenyl)-1-hydroxy-2-oxoethyl]-4-methylbenzamide.
| Compound Name | N-[(1R)-2-(4-fluorophenyl)-1-hydroxy-2-oxoethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 34256707 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-[(1R)-2-(4-fluorophenyl)-1-hydroxy-2-oxoethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H](O)C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H14FNO3/c1-10-2-4-12(5-3-10)15(20)18-16(21)14(19)11-6-8-13(17)9-7-11/h2-9,16,21H,1H3,(H,18,20)/t16-/m1/s1 |
| InChIKey | NYKNOGIPURSVEW-MRXNPFEDSA-N |
| XLogP | 2.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|