C14H13NO3S — CID 35180599
N-[(1S)-1-hydroxy-2-oxo-2-thiophen-2-ylethyl]-4-methylbenzamide (PubChem CID 35180599) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is N-[(1S)-1-hydroxy-2-oxo-2-thiophen-2-ylethyl]-4-methylbenzamide.
| Compound Name | N-[(1S)-1-hydroxy-2-oxo-2-thiophen-2-ylethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 35180599 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-[(1S)-1-hydroxy-2-oxo-2-thiophen-2-ylethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](O)C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H13NO3S/c1-9-4-6-10(7-5-9)13(17)15-14(18)12(16)11-3-2-8-19-11/h2-8,14,18H,1H3,(H,15,17)/t14-/m0/s1 |
| InChIKey | HRGJCGLDISKYES-AWEZNQCLSA-N |
| XLogP | 1.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|