C15H15NO4S2 — CID 44615102
N-[1-(4-methylphenyl)sulfonyl-2-oxo-2-thiophen-2-ylethyl]acetamide (PubChem CID 44615102) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)sulfonyl-2-oxo-2-thiophen-2-ylethyl]acetamide.
| Compound Name | N-[1-(4-methylphenyl)sulfonyl-2-oxo-2-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 44615102 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-[1-(4-methylphenyl)sulfonyl-2-oxo-2-thiophen-2-ylethyl]acetamide |
| SMILES | CC(=O)NC(C(=O)c1cccs1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H15NO4S2/c1-10-5-7-12(8-6-10)22(19,20)15(16-11(2)17)14(18)13-4-3-9-21-13/h3-9,15H,1-2H3,(H,16,17) |
| InChIKey | TYUURNXJWVPICH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |