C20H19NO4S2 — CID 25107614
benzyl N-[(4-methylphenyl)sulfonyl-thiophen-2-ylmethyl]carbamate (PubChem CID 25107614) has the molecular formula C20H19NO4S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is benzyl N-[(4-methylphenyl)sulfonyl-thiophen-2-ylmethyl]carbamate.
| Compound Name | benzyl N-[(4-methylphenyl)sulfonyl-thiophen-2-ylmethyl]carbamate |
|---|---|
| PubChem CID | 25107614 |
| Molecular Formula | C20H19NO4S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | benzyl N-[(4-methylphenyl)sulfonyl-thiophen-2-ylmethyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)C(NC(=O)OCc2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H19NO4S2/c1-15-9-11-17(12-10-15)27(23,24)19(18-8-5-13-26-18)21-20(22)25-14-16-6-3-2-4-7-16/h2-13,19H,14H2,1H3,(H,21,22) |
| InChIKey | QCAWQIJBIHKCHR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |