C24H23NO7S — CID 23034566
methyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 23034566) has the molecular formula C24H23NO7S and a molecular weight of 469.52 g/mol. Its IUPAC name is methyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | methyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 23034566 |
| Molecular Formula | C24H23NO7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | methyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | COC(=O)C(NC(=O)OCc1ccccc1)c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23NO7S/c1-17-8-14-21(15-9-17)33(28,29)32-20-12-10-19(11-13-20)22(23(26)30-2)25-24(27)31-16-18-6-4-3-5-7-18/h3-15,22H,16H2,1-2H3,(H,25,27) |
| InChIKey | WUEVIEFCVFSEEX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|