C22H27NO7S — CID 23034145
ethyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 23034145) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is ethyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | ethyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 23034145 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | ethyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H27NO7S/c1-6-28-20(24)19(23-21(25)29-22(3,4)5)16-9-11-17(12-10-16)30-31(26,27)18-13-7-15(2)8-14-18/h7-14,19H,6H2,1-5H3,(H,23,25) |
| InChIKey | GRPNUXDBJQUMHA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|