C26H29NO6S — CID 87296759
[4-[[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethoxymethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 87296759) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is [4-[[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethoxymethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethoxymethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87296759 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [4-[[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethoxymethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(NC(=O)OC(C)(C)C)OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H29NO6S/c1-19-10-16-23(17-11-19)34(29,30)33-22-14-12-21(13-15-22)24(27-25(28)32-26(2,3)4)31-18-20-8-6-5-7-9-20/h5-17,24H,18H2,1-4H3,(H,27,28) |
| InChIKey | HAHFINFRAPRCGO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|