C30H29NO5S — CID 87298265
benzyl 3-amino-2-[4-(4-methylphenyl)sulfonyloxyphenyl]-4-phenylbutanoate (PubChem CID 87298265) has the molecular formula C30H29NO5S and a molecular weight of 515.63 g/mol. Its IUPAC name is benzyl 3-amino-2-[4-(4-methylphenyl)sulfonyloxyphenyl]-4-phenylbutanoate.
| Compound Name | benzyl 3-amino-2-[4-(4-methylphenyl)sulfonyloxyphenyl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 87298265 |
| Molecular Formula | C30H29NO5S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | benzyl 3-amino-2-[4-(4-methylphenyl)sulfonyloxyphenyl]-4-phenylbutanoate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(C(=O)OCc3ccccc3)C(N)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H29NO5S/c1-22-12-18-27(19-13-22)37(33,34)36-26-16-14-25(15-17-26)29(28(31)20-23-8-4-2-5-9-23)30(32)35-21-24-10-6-3-7-11-24/h2-19,28-29H,20-21,31H2,1H3 |
| InChIKey | NWUHIGYSDQSYBF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|