C38H33NO7S — CID 87298720
4-O-benzyl 1-O-(9H-fluoren-9-ylmethyl) 2-amino-3-[4-(4-methylphenyl)sulfonyloxyphenyl]butanedioate (PubChem CID 87298720) has the molecular formula C38H33NO7S and a molecular weight of 647.75 g/mol. Its IUPAC name is 4-O-benzyl 1-O-(9H-fluoren-9-ylmethyl) 2-amino-3-[4-(4-methylphenyl)sulfonyloxyphenyl]butanedioate.
| Compound Name | 4-O-benzyl 1-O-(9H-fluoren-9-ylmethyl) 2-amino-3-[4-(4-methylphenyl)sulfonyloxyphenyl]butanedioate |
|---|---|
| PubChem CID | 87298720 |
| Molecular Formula | C38H33NO7S |
| Molecular Weight | 647.75 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | 4-O-benzyl 1-O-(9H-fluoren-9-ylmethyl) 2-amino-3-[4-(4-methylphenyl)sulfonyloxyphenyl]butanedioate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(C(=O)OCc3ccccc3)C(N)C(=O)OCC3c4ccccc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C38H33NO7S/c1-25-15-21-29(22-16-25)47(42,43)46-28-19-17-27(18-20-28)35(37(40)44-23-26-9-3-2-4-10-26)36(39)38(41)45-24-34-32-13-7-5-11-30(32)31-12-6-8-14-33(31)34/h2-22,34-36H,23-24,39H2,1H3 |
| InChIKey | JZJCQDVILOJXLB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.75 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|