C34H33NO7S — CID 87298460
1-O-(9H-fluoren-9-ylmethyl) 4-O-propan-2-yl 3-(aminomethyl)-2-[4-(benzenesulfonyloxy)phenyl]butanedioate (PubChem CID 87298460) has the molecular formula C34H33NO7S and a molecular weight of 599.71 g/mol. Its IUPAC name is 1-O-(9H-fluoren-9-ylmethyl) 4-O-propan-2-yl 3-(aminomethyl)-2-[4-(benzenesulfonyloxy)phenyl]butanedioate.
| Compound Name | 1-O-(9H-fluoren-9-ylmethyl) 4-O-propan-2-yl 3-(aminomethyl)-2-[4-(benzenesulfonyloxy)phenyl]butanedioate |
|---|---|
| PubChem CID | 87298460 |
| Molecular Formula | C34H33NO7S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 1-O-(9H-fluoren-9-ylmethyl) 4-O-propan-2-yl 3-(aminomethyl)-2-[4-(benzenesulfonyloxy)phenyl]butanedioate |
| SMILES | CC(C)OC(=O)C(CN)C(C(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H33NO7S/c1-22(2)41-33(36)30(20-35)32(23-16-18-24(19-17-23)42-43(38,39)25-10-4-3-5-11-25)34(37)40-21-31-28-14-8-6-12-26(28)27-13-7-9-15-29(27)31/h3-19,22,30-32H,20-21,35H2,1-2H3 |
| InChIKey | IPTKQORLSYJJKB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|