C33H31NO7S — CID 23034314
ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate (PubChem CID 23034314) has the molecular formula C33H31NO7S and a molecular weight of 585.68 g/mol. Its IUPAC name is ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate.
| Compound Name | ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 23034314 |
| Molecular Formula | C33H31NO7S |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H31NO7S/c1-3-39-32(35)31(20-23-14-16-24(17-15-23)41-42(37,38)25-18-12-22(2)13-19-25)34-33(36)40-21-30-28-10-6-4-8-26(28)27-9-5-7-11-29(27)30/h4-19,30-31H,3,20-21H2,1-2H3,(H,34,36) |
| InChIKey | IQJQMMKYAZRNBF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|