C27H27NO7S — CID 87298407
ethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylsulfonyloxyphenyl)propanoate (PubChem CID 87298407) has the molecular formula C27H27NO7S and a molecular weight of 509.58 g/mol. Its IUPAC name is ethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylsulfonyloxyphenyl)propanoate.
| Compound Name | ethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylsulfonyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 87298407 |
| Molecular Formula | C27H27NO7S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | ethyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylsulfonyloxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1cccc(OS(C)(=O)=O)c1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H27NO7S/c1-3-33-26(29)25(16-18-9-8-10-19(15-18)35-36(2,31)32)28-27(30)34-17-24-22-13-6-4-11-20(22)21-12-5-7-14-23(21)24/h4-15,24-25H,3,16-17H2,1-2H3,(H,28,30)/t25-/m0/s1 |
| InChIKey | KWXOERXCJONAEQ-VWLOTQADSA-N |
| XLogP | 4.04 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|