C35H35NO7S — CID 87298150
tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(4-methylphenyl)sulfonyloxyphenyl]propanoate (PubChem CID 87298150) has the molecular formula C35H35NO7S and a molecular weight of 613.73 g/mol. Its IUPAC name is tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(4-methylphenyl)sulfonyloxyphenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 87298150 |
| Molecular Formula | C35H35NO7S |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(C[C@H](NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C35H35NO7S/c1-23-16-18-26(19-17-23)44(39,40)43-25-11-9-10-24(20-25)21-32(33(37)42-35(2,3)4)36-34(38)41-22-31-29-14-7-5-12-27(29)28-13-6-8-15-30(28)31/h5-20,31-32H,21-22H2,1-4H3,(H,36,38)/t32-/m0/s1 |
| InChIKey | VDQFCHNZNRIDCZ-YTTGMZPUSA-N |
| XLogP | 6.55 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|