C29H31NO5 — CID 11038063
tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methoxyphenyl)propanoate (PubChem CID 11038063) has the molecular formula C29H31NO5 and a molecular weight of 473.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methoxyphenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 11038063 |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | tert-butyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methoxyphenyl)propanoate |
| SMILES | COc1cccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C29H31NO5/c1-29(2,3)35-27(31)26(17-19-10-9-11-20(16-19)33-4)30-28(32)34-18-25-23-14-7-5-12-21(23)22-13-6-8-15-24(22)25/h5-16,25-26H,17-18H2,1-4H3,(H,30,32)/t26-/m0/s1 |
| InChIKey | FQMXEGKKCXQODM-SANMLTNESA-N |
| XLogP | 5.49 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |