C23H26BrNO4 — CID 172529273
tert-butyl (2S)-4-bromo-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 172529273) has the molecular formula C23H26BrNO4 and a molecular weight of 460.37 g/mol. Its IUPAC name is tert-butyl (2S)-4-bromo-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl (2S)-4-bromo-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 172529273 |
| Molecular Formula | C23H26BrNO4 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | tert-butyl (2S)-4-bromo-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCBr)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H26BrNO4/c1-23(2,3)29-21(26)20(12-13-24)25-22(27)28-14-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19-20H,12-14H2,1-3H3,(H,25,27)/t20-/m0/s1 |
| InChIKey | SNHKLINVPJFJDM-FQEVSTJZSA-N |
| XLogP | 5.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|