C26H31NO6 — CID 126640932
5-O-tert-butyl 1-O-ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate (PubChem CID 126640932) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 126640932 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 5-O-tert-butyl 1-O-ethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate |
| SMILES | CCOC(=O)C(CCC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H31NO6/c1-5-31-24(29)22(14-15-23(28)33-26(2,3)4)27-25(30)32-16-21-19-12-8-6-10-17(19)18-11-7-9-13-20(18)21/h6-13,21-22H,5,14-16H2,1-4H3,(H,27,30) |
| InChIKey | LEFRUMDUBWHHLL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|