C29H38N2O7 — CID 171466792
tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoate (PubChem CID 171466792) has the molecular formula C29H38N2O7 and a molecular weight of 526.63 g/mol. Its IUPAC name is tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoate.
| Compound Name | tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 171466792 |
| Molecular Formula | C29H38N2O7 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoate |
| SMILES | COCCOCCNC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H38N2O7/c1-29(2,3)38-26(32)14-13-25(27(33)30-15-16-36-18-17-35-4)31-28(34)37-19-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-12,24-25H,13-19H2,1-4H3,(H,30,33)(H,31,34)/t25-/m0/s1 |
| InChIKey | QGFPLHAEKBYYDT-VWLOTQADSA-N |
| XLogP | 3.79 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|