C31H29F5N2O7 — CID 171466780
(2,3,4,5,6-pentafluorophenyl) (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoate (PubChem CID 171466780) has the molecular formula C31H29F5N2O7 and a molecular weight of 636.57 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 171466780 |
| Molecular Formula | C31H29F5N2O7 |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[2-(2-methoxyethoxy)ethylamino]-5-oxopentanoate |
| SMILES | COCCOCCNC(=O)[C@H](CCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H29F5N2O7/c1-42-14-15-43-13-12-37-30(40)22(10-11-23(39)45-29-27(35)25(33)24(32)26(34)28(29)36)38-31(41)44-16-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-9,21-22H,10-16H2,1H3,(H,37,40)(H,38,41)/t22-/m0/s1 |
| InChIKey | KFOFXHCETOQPBU-QFIPXVFZSA-N |
| XLogP | 4.75 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|