C30H38N2O7 — CID 171419290
butyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-oxopentanoate (PubChem CID 171419290) has the molecular formula C30H38N2O7 and a molecular weight of 538.64 g/mol. Its IUPAC name is butyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-oxopentanoate.
| Compound Name | butyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 171419290 |
| Molecular Formula | C30H38N2O7 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | butyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-5-oxopentanoate |
| SMILES | CCCCOC(=O)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H38N2O7/c1-5-6-17-37-26(33)16-15-25(28(35)31-18-27(34)39-30(2,3)4)32-29(36)38-19-24-22-13-9-7-11-20(22)21-12-8-10-14-23(21)24/h7-14,24-25H,5-6,15-19H2,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | IDYIEMBMSYAXLH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|