C25H29NO5 — CID 72802897
tert-butyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxohexanoate (PubChem CID 72802897) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxohexanoate.
| Compound Name | tert-butyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxohexanoate |
|---|---|
| PubChem CID | 72802897 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | tert-butyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxohexanoate |
| SMILES | CCC(=O)C(CC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H29NO5/c1-5-22(27)21(14-23(28)31-25(2,3)4)26-24(29)30-15-20-18-12-8-6-10-16(18)17-11-7-9-13-19(17)20/h6-13,20-21H,5,14-15H2,1-4H3,(H,26,29) |
| InChIKey | BOVORVCTMNCPCT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |