C28H30N2O4 — CID 155695557
tert-butyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-3-ylbutanoate (PubChem CID 155695557) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is tert-butyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-3-ylbutanoate.
| Compound Name | tert-butyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-3-ylbutanoate |
|---|---|
| PubChem CID | 155695557 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | tert-butyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-3-ylbutanoate |
| SMILES | CC(C)(C)OC(=O)C(CCc1cccnc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H30N2O4/c1-28(2,3)34-26(31)25(15-14-19-9-8-16-29-17-19)30-27(32)33-18-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h4-13,16-17,24-25H,14-15,18H2,1-3H3,(H,30,32) |
| InChIKey | ZZVCBKJTBRGJTE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |