C22H24ClNO4 — CID 85305821
tert-butyl 3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 85305821) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is tert-butyl 3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl 3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 85305821 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | tert-butyl 3-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)C(CCl)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H24ClNO4/c1-22(2,3)28-20(25)19(12-23)24-21(26)27-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,24,26) |
| InChIKey | WVZKVIMZYKEFDP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|