C25H24N2O4 — CID 172894277
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(5-methyl-3-pyridinyl)butanoic acid (PubChem CID 172894277) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(5-methyl-3-pyridinyl)butanoic acid.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(5-methyl-3-pyridinyl)butanoic acid |
|---|---|
| PubChem CID | 172894277 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(5-methyl-3-pyridinyl)butanoic acid |
| SMILES | Cc1cncc(CC[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-16-12-17(14-26-13-16)10-11-23(24(28)29)27-25(30)31-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-9,12-14,22-23H,10-11,15H2,1H3,(H,27,30)(H,28,29)/t23-/m1/s1 |
| InChIKey | VCIFULJFNIXNOY-HSZRJFAPSA-N |
| XLogP | 4.31 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |