C24H21ClN2O4 — CID 172894294
(2R)-4-(4-chloro-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (PubChem CID 172894294) has the molecular formula C24H21ClN2O4 and a molecular weight of 436.90 g/mol. Its IUPAC name is (2R)-4-(4-chloro-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2R)-4-(4-chloro-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 172894294 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (2R)-4-(4-chloro-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(N[C@H](CCc1cnccc1Cl)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21ClN2O4/c25-21-11-12-26-13-15(21)9-10-22(23(28)29)27-24(30)31-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,11-13,20,22H,9-10,14H2,(H,27,30)(H,28,29)/t22-/m1/s1 |
| InChIKey | AXWDSAPRKXIOEK-JOCHJYFZSA-N |
| XLogP | 4.66 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |