C40H40N2O8Se2 — CID 11506078
ethyl (2R)-3-[[(2R)-3-ethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]diselanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 11506078) has the molecular formula C40H40N2O8Se2 and a molecular weight of 834.69 g/mol. Its IUPAC name is ethyl (2R)-3-[[(2R)-3-ethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]diselanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl (2R)-3-[[(2R)-3-ethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]diselanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 11506078 |
| Molecular Formula | C40H40N2O8Se2 |
| Molecular Weight | 834.69 g/mol |
| Exact Mass | 836.11 |
| IUPAC Name | ethyl (2R)-3-[[(2R)-3-ethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropyl]diselanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)[C@H](C[Se][Se]C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C40H40N2O8Se2/c1-3-47-37(43)35(41-39(45)49-21-33-29-17-9-5-13-25(29)26-14-6-10-18-30(26)33)23-51-52-24-36(38(44)48-4-2)42-40(46)50-22-34-31-19-11-7-15-27(31)28-16-8-12-20-32(28)34/h5-20,33-36H,3-4,21-24H2,1-2H3,(H,41,45)(H,42,46)/t35-,36-/m0/s1 |
| InChIKey | GBFFJOWUAMQAOB-ZPGRZCPFSA-N |
| XLogP | 6.09 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|