C24H27NO4 — CID 138502561
prop-2-enyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 138502561) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is prop-2-enyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | prop-2-enyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 138502561 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | prop-2-enyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | C=CCOC(=O)C(CCCC)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H27NO4/c1-3-5-14-22(23(26)28-15-4-2)25-24(27)29-16-21-19-12-8-6-10-17(19)18-11-7-9-13-20(18)21/h4,6-13,21-22H,2-3,5,14-16H2,1H3,(H,25,27) |
| InChIKey | CHTHGQYZENMMHX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|