C23H28N2O5 — CID 131676586
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid;formamide (PubChem CID 131676586) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid;formamide.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid;formamide |
|---|---|
| PubChem CID | 131676586 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid;formamide |
| SMILES | CCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.NC=O |
| InChI | InChI=1S/C22H25NO4.CH3NO/c1-2-3-4-13-20(21(24)25)23-22(26)27-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19;2-1-3/h5-12,19-20H,2-4,13-14H2,1H3,(H,23,26)(H,24,25);1H,(H2,2,3)/t20-;/m0./s1 |
| InChIKey | LXWDLUZYHUOORP-BDQAORGHSA-N |
| XLogP | 3.66 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|