C26H30N2O7 — CID 175837350
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]pentanedioic acid (PubChem CID 175837350) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 175837350 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl]amino]pentanedioic acid |
| SMILES | CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H30N2O7/c1-2-3-12-21(24(31)27-22(25(32)33)13-14-23(29)30)28-26(34)35-15-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-11,20-22H,2-3,12-15H2,1H3,(H,27,31)(H,28,34)(H,29,30)(H,32,33)/t21-,22-/m0/s1 |
| InChIKey | PAVMHEMHYKRECX-VXKWHMMOSA-N |
| XLogP | 3.52 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |