C22H23NO6 — CID 93478024
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid (PubChem CID 93478024) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid |
|---|---|
| PubChem CID | 93478024 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanedioic acid |
| SMILES | O=C(O)CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H23NO6/c24-20(25)12-6-5-11-19(21(26)27)23-22(28)29-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18/h1-4,7-10,18-19H,5-6,11-13H2,(H,23,28)(H,24,25)(H,26,27)/t19-/m0/s1 |
| InChIKey | WNGQUSSMDLUWLH-IBGZPJMESA-N |
| XLogP | 3.62 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|