C22H24INO4 — CID 19604102
2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-iodoheptanoic acid (PubChem CID 19604102) has the molecular formula C22H24INO4 and a molecular weight of 493.34 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-iodoheptanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-iodoheptanoic acid |
|---|---|
| PubChem CID | 19604102 |
| Molecular Formula | C22H24INO4 |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-iodoheptanoic acid |
| SMILES | O=C(NC(CCCCCI)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H24INO4/c23-13-7-1-2-12-20(21(25)26)24-22(27)28-14-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)19/h3-6,8-11,19-20H,1-2,7,12-14H2,(H,24,27)(H,25,26) |
| InChIKey | DWLBAGFQVCCRKI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|