C25H35ClN2O4 — CID 131676595
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;tetramethylazanium;chloride (PubChem CID 131676595) has the molecular formula C25H35ClN2O4 and a molecular weight of 463.02 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;tetramethylazanium;chloride.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;tetramethylazanium;chloride |
|---|---|
| PubChem CID | 131676595 |
| Molecular Formula | C25H35ClN2O4 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;tetramethylazanium;chloride |
| SMILES | CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.C[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C21H23NO4.C4H12N.ClH/c1-2-3-12-19(20(23)24)22-21(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18;1-5(2,3)4;/h4-11,18-19H,2-3,12-13H2,1H3,(H,22,25)(H,23,24);1-4H3;1H/q;+1;/p-1/t19-;;/m0../s1 |
| InChIKey | BFDVICKVSASWSX-TXEPZDRESA-M |
| XLogP | 1.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|