C28H38N2O6 — CID 131676601
tert-butyl N-methylcarbamate;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid (PubChem CID 131676601) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid.
| Compound Name | tert-butyl N-methylcarbamate;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 131676601 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | tert-butyl N-methylcarbamate;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)heptanoic acid |
| SMILES | CCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O.CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H25NO4.C6H13NO2/c1-2-3-4-13-20(21(24)25)23-22(26)27-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19;1-6(2,3)9-5(8)7-4/h5-12,19-20H,2-4,13-14H2,1H3,(H,23,26)(H,24,25);1-4H3,(H,7,8)/t20-;/m0./s1 |
| InChIKey | LZVGKEXEYHRFML-BDQAORGHSA-N |
| XLogP | 5.70 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|