C34H47N3O7 — CID 59866849
methyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]heptanoate (PubChem CID 59866849) has the molecular formula C34H47N3O7 and a molecular weight of 609.76 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]heptanoate.
| Compound Name | methyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]heptanoate |
|---|---|
| PubChem CID | 59866849 |
| Molecular Formula | C34H47N3O7 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | methyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]heptanoate |
| SMILES | CCCCCC(NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC |
| InChI | InChI=1S/C34H47N3O7/c1-6-7-8-20-29(31(39)42-5)36-30(38)28(19-13-14-21-35-32(40)44-34(2,3)4)37-33(41)43-22-27-25-17-11-9-15-23(25)24-16-10-12-18-26(24)27/h9-12,15-18,27-29H,6-8,13-14,19-22H2,1-5H3,(H,35,40)(H,36,38)(H,37,41)/t28-,29?/m0/s1 |
| InChIKey | YPLSILTUGYERAD-XLTVJXRZSA-N |
| XLogP | 5.83 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|