C31H41N3O8 — CID 15138216
methyl (2S,3R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-hydroxybutanoate (PubChem CID 15138216) has the molecular formula C31H41N3O8 and a molecular weight of 583.68 g/mol. Its IUPAC name is methyl (2S,3R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-hydroxybutanoate.
| Compound Name | methyl (2S,3R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 15138216 |
| Molecular Formula | C31H41N3O8 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | methyl (2S,3R)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-hydroxybutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](C)O |
| InChI | InChI=1S/C31H41N3O8/c1-19(35)26(28(37)40-5)34-27(36)25(16-10-11-17-32-29(38)42-31(2,3)4)33-30(39)41-18-24-22-14-8-6-12-20(22)21-13-7-9-15-23(21)24/h6-9,12-15,19,24-26,35H,10-11,16-18H2,1-5H3,(H,32,38)(H,33,39)(H,34,36)/t19-,25+,26+/m1/s1 |
| InChIKey | HBNOGEBYIMTBAI-PBXQCXKZSA-N |
| XLogP | 3.63 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|