C26H31BF3KN2O5 — CID 164673893
potassium [(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-trifluoroboranuide (PubChem CID 164673893) has the molecular formula C26H31BF3KN2O5 and a molecular weight of 558.45 g/mol. Its IUPAC name is potassium [(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-trifluoroboranuide.
| Compound Name | potassium [(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 164673893 |
| Molecular Formula | C26H31BF3KN2O5 |
| Molecular Weight | 558.45 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | potassium [(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-trifluoroboranuide |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C26H31BF3N2O5.K/c1-26(2,3)37-24(34)31-15-9-8-14-22(23(33)27(28,29)30)32-25(35)36-16-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21;/h4-7,10-13,21-22H,8-9,14-16H2,1-3H3,(H,31,34)(H,32,35);/q-1;+1/t22-;/m0./s1 |
| InChIKey | MFNPTCANIIELPX-FTBISJDPSA-N |
| XLogP | 2.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|