C28H36N4O7 — CID 138611833
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylcarbamoylamino]propanoic acid (PubChem CID 138611833) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylcarbamoylamino]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 138611833 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylcarbamoylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=O)NCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C28H36N4O7/c1-28(2,3)39-26(36)30-15-9-8-14-29-25(35)31-16-23(24(33)34)32-27(37)38-17-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h4-7,10-13,22-23H,8-9,14-17H2,1-3H3,(H,30,36)(H,32,37)(H,33,34)(H2,29,31,35) |
| InChIKey | JIJSYSJRGJUFKN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|