C29H38N4O7 — CID 138611797
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylcarbamoylamino]propanoic acid (PubChem CID 138611797) has the molecular formula C29H38N4O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylcarbamoylamino]propanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 138611797 |
| Molecular Formula | C29H38N4O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylcarbamoylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(=O)NC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C29H38N4O7/c1-29(2,3)40-27(37)31-16-10-4-9-15-30-26(36)32-17-24(25(34)35)33-28(38)39-18-23-21-13-7-5-11-19(21)20-12-6-8-14-22(20)23/h5-8,11-14,23-24H,4,9-10,15-18H2,1-3H3,(H,31,37)(H,33,38)(H,34,35)(H2,30,32,36)/t24-/m0/s1 |
| InChIKey | WQOCDWJJBOURML-DEOSSOPVSA-N |
| XLogP | 3.97 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|