C37H36N2O6 — CID 75487884
methyl (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 75487884) has the molecular formula C37H36N2O6 and a molecular weight of 604.70 g/mol. Its IUPAC name is methyl (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 75487884 |
| Molecular Formula | C37H36N2O6 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | methyl (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H36N2O6/c1-43-35(40)34(39-37(42)45-23-33-30-18-8-4-14-26(30)27-15-5-9-19-31(27)33)20-10-11-21-38-36(41)44-22-32-28-16-6-2-12-24(28)25-13-3-7-17-29(25)32/h2-9,12-19,32-34H,10-11,20-23H2,1H3,(H,38,41)(H,39,42)/t34-/m0/s1 |
| InChIKey | FFVMSCGZOOPEBG-UMSFTDKQSA-N |
| XLogP | 6.78 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|