C72H66N4O11 — CID 54560651
[(2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl] (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 54560651) has the molecular formula C72H66N4O11 and a molecular weight of 1163.34 g/mol. Its IUPAC name is [(2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl] (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | [(2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl] (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 54560651 |
| Molecular Formula | C72H66N4O11 |
| Molecular Weight | 1163.34 g/mol |
| Exact Mass | 1162.47 |
| IUPAC Name | [(2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl] (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | O=C(NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(=O)[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)OCC1c2ccccc2-c2ccccc21)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C72H66N4O11/c77-67(65(75-71(81)85-43-63-57-33-13-5-25-49(57)50-26-6-14-34-58(50)63)37-17-19-39-73-69(79)83-41-61-53-29-9-1-21-45(53)46-22-2-10-30-54(46)61)87-68(78)66(76-72(82)86-44-64-59-35-15-7-27-51(59)52-28-8-16-36-60(52)64)38-18-20-40-74-70(80)84-42-62-55-31-11-3-23-47(55)48-24-4-12-32-56(48)62/h1-16,21-36,61-66H,17-20,37-44H2,(H,73,79)(H,74,80)(H,75,81)(H,76,82)/t65-,66-/m0/s1 |
| InChIKey | ZQHLPENZVYNLDN-XDVNEXBFSA-N |
| XLogP | 13.29 |
| TPSA | 196.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.34 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|