C28H34N2O6 — CID 164907286
propyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoate (PubChem CID 164907286) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is propyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoate.
| Compound Name | propyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 164907286 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | propyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoate |
| SMILES | C=CCOC(=O)NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCCC |
| InChI | InChI=1S/C28H34N2O6/c1-3-17-34-26(31)25(15-9-10-16-29-27(32)35-18-4-2)30-28(33)36-19-24-22-13-7-5-11-20(22)21-12-6-8-14-23(21)24/h4-8,11-14,24-25H,2-3,9-10,15-19H2,1H3,(H,29,32)(H,30,33)/t25-/m0/s1 |
| InChIKey | MVKTYGOXQQXTOX-VWLOTQADSA-N |
| XLogP | 4.93 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|